Iron MHA (Iron Methionine Hydroxy Analogue) Chelate
In stock
Description
Iron MHA stands for Iron Methionine Hydroxy Analogue Chelate. It is often referred to in scientific literature as Fe-HMA.
It is an organic trace mineral complex where a central iron ion is chemically bound (chelated) to an organic ligand called 2-hydroxy-4-(methylthio)butanoic acid (HMTBa). This ligand functions as a structural analogue, or substitute, for the essential amino acid methionine.Iron MHA: CAS No. 292140-31-9
Specifications
| CAS NO | 292140-31-9 |
|---|---|
| Solubility | Highly stable over a wide range of acidic and basic pH levels in the gut, ensuring it does not prematurely break apart. |
| Chemical Formula: | Fe(CH3S(CH2)2-CH(OH)-COO)2 |
| Molecular Weight: | 354.2 g/mol |
| Physical Appearance: | Fine, free-flowing powder, typically light brown to tan in color |
| Chemical Structure: | : Built as a stable coordination matrix where a central iron ion is securely held in place by two surrounding MHA organic rings. |